C30H28O5 — CID 89210906
[6-(2-methylprop-2-enoyloxymethyl)naphthalen-2-yl] (E)-2-methyl-3-[4-(3-methyl-2-oxobut-3-enyl)phenyl]prop-2-enoate (PubChem CID 89210906) has the molecular formula C30H28O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is [6-(2-methylprop-2-enoyloxymethyl)naphthalen-2-yl] (E)-2-methyl-3-[4-(3-methyl-2-oxobut-3-enyl)phenyl]prop-2-enoate.
| Compound Name | [6-(2-methylprop-2-enoyloxymethyl)naphthalen-2-yl] (E)-2-methyl-3-[4-(3-methyl-2-oxobut-3-enyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 89210906 |
| Molecular Formula | C30H28O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | [6-(2-methylprop-2-enoyloxymethyl)naphthalen-2-yl] (E)-2-methyl-3-[4-(3-methyl-2-oxobut-3-enyl)phenyl]prop-2-enoate |
| SMILES | C=C(C)C(=O)Cc1ccc(/C=C(\C)C(=O)Oc2ccc3cc(COC(=O)C(=C)C)ccc3c2)cc1 |
| InChI | InChI=1S/C30H28O5/c1-19(2)28(31)16-23-8-6-22(7-9-23)14-21(5)30(33)35-27-13-12-25-15-24(10-11-26(25)17-27)18-34-29(32)20(3)4/h6-15,17H,1,3,16,18H2,2,4-5H3/b21-14+ |
| InChIKey | GVRAPXYWHWTLHB-KGENOOAVSA-N |
| XLogP | 6.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|