C17H22N3O3S+ — CID 8921314
[(1S)-1-(furan-2-yl)ethyl]-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]azanium (PubChem CID 8921314) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is [(1S)-1-(furan-2-yl)ethyl]-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]azanium.
| Compound Name | [(1S)-1-(furan-2-yl)ethyl]-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 8921314 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(1S)-1-(furan-2-yl)ethyl]-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)N1CCN(C(=O)c2cccs2)CC1)c1ccco1 |
| InChI | InChI=1S/C17H21N3O3S/c1-13(14-4-2-10-23-14)18-12-16(21)19-6-8-20(9-7-19)17(22)15-5-3-11-24-15/h2-5,10-11,13,18H,6-9,12H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | MBYDJTAMUNFVCM-ZDUSSCGKSA-O |
| XLogP | 0.95 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |