C7H12FN — CID 89214767
(2E,4E)-3-fluorohepta-2,4-dien-4-amine (PubChem CID 89214767) has the molecular formula C7H12FN and a molecular weight of 129.18 g/mol. Its IUPAC name is (2E,4E)-3-fluorohepta-2,4-dien-4-amine.
| Compound Name | (2E,4E)-3-fluorohepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 89214767 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (2E,4E)-3-fluorohepta-2,4-dien-4-amine |
| SMILES | C/C=C(F)\C(N)=C/CC |
| InChI | InChI=1S/C7H12FN/c1-3-5-7(9)6(8)4-2/h4-5H,3,9H2,1-2H3/b6-4+,7-5+ |
| InChIKey | ZFMVJGSKNDABHX-YDFGWWAZSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|