About (2E,4E)-3-fluorohepta-2,4-dien-4-amine
(2E,4E)-3-fluorohepta-2,4-dien-4-amine (PubChem CID 89214767) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is (2E,4E)-3-fluorohepta-2,4-dien-4-amine.
Molecular Properties
| Compound Name | (2E,4E)-3-fluorohepta-2,4-dien-4-amine |
| PubChem CID | 89214767 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (2E,4E)-3-fluorohepta-2,4-dien-4-amine |
| SMILES | C/C=C(F)\C(N)=C/CC |
| InChI | InChI=1S/C7H12FN/c1-3-5-7(9)6(8)4-2/h4-5H,3,9H2,1-2H3/b6-4+,7-5+ |
| InChIKey | ZFMVJGSKNDABHX-YDFGWWAZSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-fluorohepta-2,4-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-fluorohepta-2,4-dien-4-amine?
The IUPAC name of (2E,4E)-3-fluorohepta-2,4-dien-4-amine (CID 89214767) is (2E,4E)-3-fluorohepta-2,4-dien-4-amine.
What is the SMILES notation for (2E,4E)-3-fluorohepta-2,4-dien-4-amine?
The canonical SMILES for (2E,4E)-3-fluorohepta-2,4-dien-4-amine is C/C=C(F)\C(N)=C/CC.
What is the InChIKey of (2E,4E)-3-fluorohepta-2,4-dien-4-amine?
The InChIKey is ZFMVJGSKNDABHX-YDFGWWAZSA-N. The full InChI is InChI=1S/C7H12FN/c1-3-5-7(9)6(8)4-2/h4-5H,3,9H2,1-2H3/b6-4+,7-5+.
What are the key properties of (2E,4E)-3-fluorohepta-2,4-dien-4-amine?
(2E,4E)-3-fluorohepta-2,4-dien-4-amine has a molecular weight of 129.18 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-fluorohepta-2,4-dien-4-amine is sourced from PubChem (CID 89214767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).