C16H28N2O — CID 89215154
(3Z,5E)-3,4-dimethyl-5-(2,3,6-trimethylmorpholin-4-yl)hepta-1,3,5-trien-2-amine (PubChem CID 89215154) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (3Z,5E)-3,4-dimethyl-5-(2,3,6-trimethylmorpholin-4-yl)hepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5E)-3,4-dimethyl-5-(2,3,6-trimethylmorpholin-4-yl)hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 89215154 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (3Z,5E)-3,4-dimethyl-5-(2,3,6-trimethylmorpholin-4-yl)hepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C(C)=C(C)\C(=C/C)N1CC(C)OC(C)C1C |
| InChI | InChI=1S/C16H28N2O/c1-8-16(12(4)11(3)13(5)17)18-9-10(2)19-15(7)14(18)6/h8,10,14-15H,5,9,17H2,1-4,6-7H3/b12-11-,16-8+ |
| InChIKey | FFKWMBAILCNYMZ-JCQHQYFWSA-N |
| XLogP | 3.20 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|