C27H28F3N5O4S — CID 89217091
5-[(3R)-3-[(4-propylphenyl)methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 89217091) has the molecular formula C27H28F3N5O4S and a molecular weight of 575.61 g/mol. Its IUPAC name is 5-[(3R)-3-[(4-propylphenyl)methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[(3R)-3-[(4-propylphenyl)methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 89217091 |
| Molecular Formula | C27H28F3N5O4S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 5-[(3R)-3-[(4-propylphenyl)methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfanylpiperazin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | CCCc1ccc(CNC(=O)[C@H]2CN(c3cnc(C(=O)O)cn3)CCN2Sc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H28F3N5O4S/c1-2-3-18-4-6-19(7-5-18)14-33-25(36)23-17-34(24-16-31-22(15-32-24)26(37)38)12-13-35(23)40-21-10-8-20(9-11-21)39-27(28,29)30/h4-11,15-16,23H,2-3,12-14,17H2,1H3,(H,33,36)(H,37,38)/t23-/m1/s1 |
| InChIKey | WELJDZZWOUEPPO-HSZRJFAPSA-N |
| XLogP | 4.54 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|