C34H47BN3O9S — CID 89217943
CID 89217943 (PubChem CID 89217943) has the molecular formula C34H47BN3O9S and a molecular weight of 684.64 g/mol.
| Compound Name | CID 89217943 |
|---|---|
| PubChem CID | 89217943 |
| Molecular Formula | C34H47BN3O9S |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | — |
| SMILES | C=CCCCCC[C@H](NC(=O)OC1CCCC1)C(=O)N1C[C@@H](OS(=O)(=O)c2ccc([B]C)cc2)C[C@H]1C(=O)N[C@]1(C(=O)OC)C[C@H]1C=C |
| InChI | InChI=1S/C34H47BN3O9S/c1-5-7-8-9-10-15-28(36-33(42)46-25-13-11-12-14-25)31(40)38-22-26(47-48(43,44)27-18-16-24(35-3)17-19-27)20-29(38)30(39)37-34(32(41)45-4)21-23(34)6-2/h5-6,16-19,23,25-26,28-29H,1-2,7-15,20-22H2,3-4H3,(H,36,42)(H,37,39)/t23-,26+,28+,29+,34-/m1/s1 |
| InChIKey | HXKWNUNKZGXZLZ-VBSMQMFOSA-N |
| XLogP | 3.15 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|