C24H25ClN4O3 — CID 89219457
ethyl 4-[2-(2-chlorophenyl)-7-(1-methoxyethenyl)quinazolin-4-yl]piperazine-1-carboxylate (PubChem CID 89219457) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is ethyl 4-[2-(2-chlorophenyl)-7-(1-methoxyethenyl)quinazolin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-chlorophenyl)-7-(1-methoxyethenyl)quinazolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89219457 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | ethyl 4-[2-(2-chlorophenyl)-7-(1-methoxyethenyl)quinazolin-4-yl]piperazine-1-carboxylate |
| SMILES | C=C(OC)c1ccc2c(N3CCN(C(=O)OCC)CC3)nc(-c3ccccc3Cl)nc2c1 |
| InChI | InChI=1S/C24H25ClN4O3/c1-4-32-24(30)29-13-11-28(12-14-29)23-19-10-9-17(16(2)31-3)15-21(19)26-22(27-23)18-7-5-6-8-20(18)25/h5-10,15H,2,4,11-14H2,1,3H3 |
| InChIKey | BPPGPJGJOBPMJW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|