C29H27Cl3FN3O5 — CID 89219548
3-chloro-5-[6-chloro-3-[[5-[2-chloro-4-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline (PubChem CID 89219548) has the molecular formula C29H27Cl3FN3O5 and a molecular weight of 622.91 g/mol. Its IUPAC name is 3-chloro-5-[6-chloro-3-[[5-[2-chloro-4-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline.
| Compound Name | 3-chloro-5-[6-chloro-3-[[5-[2-chloro-4-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline |
|---|---|
| PubChem CID | 89219548 |
| Molecular Formula | C29H27Cl3FN3O5 |
| Molecular Weight | 622.91 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 3-chloro-5-[6-chloro-3-[[5-[2-chloro-4-[[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methoxy]phenyl]-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline |
| SMILES | CC1(C)O[C@@H](COc2ccc(-c3nnc(Cc4ccc(Cl)c(Oc5cc(N)cc(Cl)c5)c4F)o3)c(Cl)c2)C(C)(C)O1 |
| InChI | InChI=1S/C29H27Cl3FN3O5/c1-28(2)23(40-29(3,4)41-28)14-37-18-6-7-20(22(32)13-18)27-36-35-24(39-27)9-15-5-8-21(31)26(25(15)33)38-19-11-16(30)10-17(34)12-19/h5-8,10-13,23H,9,14,34H2,1-4H3/t23-/m0/s1 |
| InChIKey | DUVROIJTGMKOGA-QHCPKHFHSA-N |
| XLogP | 8.11 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.91 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|