C23H18Cl2FN3O2 — CID 89219533
3-chloro-5-[6-chloro-3-[[5-(2,6-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline (PubChem CID 89219533) has the molecular formula C23H18Cl2FN3O2 and a molecular weight of 458.32 g/mol. Its IUPAC name is 3-chloro-5-[6-chloro-3-[[5-(2,6-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline.
| Compound Name | 3-chloro-5-[6-chloro-3-[[5-(2,6-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline |
|---|---|
| PubChem CID | 89219533 |
| Molecular Formula | C23H18Cl2FN3O2 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 3-chloro-5-[6-chloro-3-[[5-(2,6-dimethylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-2-fluorophenoxy]aniline |
| SMILES | Cc1cccc(C)c1-c1nnc(Cc2ccc(Cl)c(Oc3cc(N)cc(Cl)c3)c2F)o1 |
| InChI | InChI=1S/C23H18Cl2FN3O2/c1-12-4-3-5-13(2)20(12)23-29-28-19(31-23)8-14-6-7-18(25)22(21(14)26)30-17-10-15(24)9-16(27)11-17/h3-7,9-11H,8,27H2,1-2H3 |
| InChIKey | PJVNWHWLOYORNP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|