C17H17ClF3N5 — CID 89221608
5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 89221608) has the molecular formula C17H17ClF3N5 and a molecular weight of 383.81 g/mol. Its IUPAC name is 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 89221608 |
| Molecular Formula | C17H17ClF3N5 |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-chloro-7-(4-methylpiperidin-1-yl)-6-(2,4,6-trifluorocyclohexa-1,3-dien-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CC1CCN(c2c(C3=C(F)C=C(F)CC3F)c(Cl)nc3ncnn23)CC1 |
| InChI | InChI=1S/C17H17ClF3N5/c1-9-2-4-25(5-3-9)16-14(13-11(20)6-10(19)7-12(13)21)15(18)24-17-22-8-23-26(16)17/h6,8-9,12H,2-5,7H2,1H3 |
| InChIKey | XUTXDUFTKNJZRH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |