C15H31Cl — CID 89222081
5-chloro-2,2,3,9,9-pentamethyldecane (PubChem CID 89222081) has the molecular formula C15H31Cl and a molecular weight of 246.87 g/mol. Its IUPAC name is 5-chloro-2,2,3,9,9-pentamethyldecane.
| Compound Name | 5-chloro-2,2,3,9,9-pentamethyldecane |
|---|---|
| PubChem CID | 89222081 |
| Molecular Formula | C15H31Cl |
| Molecular Weight | 246.87 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 5-chloro-2,2,3,9,9-pentamethyldecane |
| SMILES | CC(CC(Cl)CCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31Cl/c1-12(15(5,6)7)11-13(16)9-8-10-14(2,3)4/h12-13H,8-11H2,1-7H3 |
| InChIKey | KGNLKGOWZSIFIP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.87 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|