C7H12O6 — CID 89222329
(1R,4R)-3-(hydroxymethyl)-5-methoxy-2,7-dioxabicyclo[4.1.0]heptane-1,4-diol (PubChem CID 89222329) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (1R,4R)-3-(hydroxymethyl)-5-methoxy-2,7-dioxabicyclo[4.1.0]heptane-1,4-diol.
| Compound Name | (1R,4R)-3-(hydroxymethyl)-5-methoxy-2,7-dioxabicyclo[4.1.0]heptane-1,4-diol |
|---|---|
| PubChem CID | 89222329 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1R,4R)-3-(hydroxymethyl)-5-methoxy-2,7-dioxabicyclo[4.1.0]heptane-1,4-diol |
| SMILES | COC1C2O[C@@]2(O)OC(CO)[C@H]1O |
| InChI | InChI=1S/C7H12O6/c1-11-5-4(9)3(2-8)12-7(10)6(5)13-7/h3-6,8-10H,2H2,1H3/t3?,4-,5?,6?,7+/m1/s1 |
| InChIKey | QIRQKBJOUSMORE-PJPGOQRTSA-N |
| XLogP | -2.20 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|