C26H33N5O4S2 — CID 89223151
2-[[(1E,3Z)-1-amino-5-(morpholin-4-ylmethyl)hexa-1,3,5-trienyl]amino]-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]thiophene-3-carboxamide (PubChem CID 89223151) has the molecular formula C26H33N5O4S2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 2-[[(1E,3Z)-1-amino-5-(morpholin-4-ylmethyl)hexa-1,3,5-trienyl]amino]-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2-[[(1E,3Z)-1-amino-5-(morpholin-4-ylmethyl)hexa-1,3,5-trienyl]amino]-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 89223151 |
| Molecular Formula | C26H33N5O4S2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-[[(1E,3Z)-1-amino-5-(morpholin-4-ylmethyl)hexa-1,3,5-trienyl]amino]-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]thiophene-3-carboxamide |
| SMILES | C=C(/C=C\C=C(/N)Nc1sc(-c2ccc(N3CCS(=O)(=O)CC3)cc2)cc1C(N)=O)CN1CCOCC1 |
| InChI | InChI=1S/C26H33N5O4S2/c1-19(18-30-9-13-35-14-10-30)3-2-4-24(27)29-26-22(25(28)32)17-23(36-26)20-5-7-21(8-6-20)31-11-15-37(33,34)16-12-31/h2-8,17,29H,1,9-16,18,27H2,(H2,28,32)/b3-2-,24-4+ |
| InChIKey | ZGGWCQIGJVMVJW-XYTLTBOKSA-N |
| XLogP | 2.41 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|