C28H31FN4O4S — CID 89223157
5-[2-fluoro-4-(2-hydroxypropan-2-yl)phenyl]-2-[[6-[[(4R)-4-oxaldehydoylazepan-1-yl]methyl]-2-pyridinyl]amino]thiophene-3-carboxamide (PubChem CID 89223157) has the molecular formula C28H31FN4O4S and a molecular weight of 538.65 g/mol. Its IUPAC name is 5-[2-fluoro-4-(2-hydroxypropan-2-yl)phenyl]-2-[[6-[[(4R)-4-oxaldehydoylazepan-1-yl]methyl]-2-pyridinyl]amino]thiophene-3-carboxamide.
| Compound Name | 5-[2-fluoro-4-(2-hydroxypropan-2-yl)phenyl]-2-[[6-[[(4R)-4-oxaldehydoylazepan-1-yl]methyl]-2-pyridinyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 89223157 |
| Molecular Formula | C28H31FN4O4S |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 5-[2-fluoro-4-(2-hydroxypropan-2-yl)phenyl]-2-[[6-[[(4R)-4-oxaldehydoylazepan-1-yl]methyl]-2-pyridinyl]amino]thiophene-3-carboxamide |
| SMILES | CC(C)(O)c1ccc(-c2cc(C(N)=O)c(Nc3cccc(CN4CCC[C@@H](C(=O)C=O)CC4)n3)s2)c(F)c1 |
| InChI | InChI=1S/C28H31FN4O4S/c1-28(2,37)18-8-9-20(22(29)13-18)24-14-21(26(30)36)27(38-24)32-25-7-3-6-19(31-25)15-33-11-4-5-17(10-12-33)23(35)16-34/h3,6-9,13-14,16-17,37H,4-5,10-12,15H2,1-2H3,(H2,30,36)(H,31,32)/t17-/m1/s1 |
| InChIKey | PLWMAPVDZJKRQX-QGZVFWFLSA-N |
| XLogP | 4.39 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|