C17H18N4O2S — CID 59526270
5-ethynyl-2-[[6-(morpholin-4-ylmethyl)-2-pyridinyl]amino]thiophene-3-carboxamide (PubChem CID 59526270) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-ethynyl-2-[[6-(morpholin-4-ylmethyl)-2-pyridinyl]amino]thiophene-3-carboxamide.
| Compound Name | 5-ethynyl-2-[[6-(morpholin-4-ylmethyl)-2-pyridinyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 59526270 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 5-ethynyl-2-[[6-(morpholin-4-ylmethyl)-2-pyridinyl]amino]thiophene-3-carboxamide |
| SMILES | C#Cc1cc(C(N)=O)c(Nc2cccc(CN3CCOCC3)n2)s1 |
| InChI | InChI=1S/C17H18N4O2S/c1-2-13-10-14(16(18)22)17(24-13)20-15-5-3-4-12(19-15)11-21-6-8-23-9-7-21/h1,3-5,10H,6-9,11H2,(H2,18,22)(H,19,20) |
| InChIKey | OCSMTNFMEQAJEG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|