C15H23N3O3 — CID 67025080
tert-butyl N-[6-(morpholin-4-ylmethyl)-2-pyridinyl]carbamate (PubChem CID 67025080) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl N-[6-(morpholin-4-ylmethyl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(morpholin-4-ylmethyl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 67025080 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tert-butyl N-[6-(morpholin-4-ylmethyl)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CN2CCOCC2)n1 |
| InChI | InChI=1S/C15H23N3O3/c1-15(2,3)21-14(19)17-13-6-4-5-12(16-13)11-18-7-9-20-10-8-18/h4-6H,7-11H2,1-3H3,(H,16,17,19) |
| InChIKey | IQZIUFPWZRAOEK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |