C14H23N3O — CID 79231488
6-(1,4-oxazepan-4-ylmethyl)-N-propylpyridin-2-amine (PubChem CID 79231488) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 6-(1,4-oxazepan-4-ylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 6-(1,4-oxazepan-4-ylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 79231488 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 6-(1,4-oxazepan-4-ylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(CN2CCCOCC2)n1 |
| InChI | InChI=1S/C14H23N3O/c1-2-7-15-14-6-3-5-13(16-14)12-17-8-4-10-18-11-9-17/h3,5-6H,2,4,7-12H2,1H3,(H,15,16) |
| InChIKey | ZQBDZJGRIWQJJH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |