C12H17ClO7 — CID 89223193
methyl (1S,4aS,5S,6S,7R,7aS)-1-(chloromethoxy)-5,6,7-trihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate (PubChem CID 89223193) has the molecular formula C12H17ClO7 and a molecular weight of 308.71 g/mol. Its IUPAC name is methyl (1S,4aS,5S,6S,7R,7aS)-1-(chloromethoxy)-5,6,7-trihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,5S,6S,7R,7aS)-1-(chloromethoxy)-5,6,7-trihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 89223193 |
| Molecular Formula | C12H17ClO7 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl (1S,4aS,5S,6S,7R,7aS)-1-(chloromethoxy)-5,6,7-trihydroxy-7-methyl-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OCCl)[C@H]2[C@@H]1[C@H](O)[C@H](O)[C@]2(C)O |
| InChI | InChI=1S/C12H17ClO7/c1-12(17)7-6(8(14)9(12)15)5(10(16)18-2)3-19-11(7)20-4-13/h3,6-9,11,14-15,17H,4H2,1-2H3/t6-,7-,8+,9+,11+,12-/m1/s1 |
| InChIKey | XDMSXRFPKWJGEV-UUIHKPMRSA-N |
| XLogP | -0.67 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|