C13H16O5 — CID 163433195
methyl (1S,2R,6S,7S,11S)-6,11-dihydroxy-2-methyl-10-oxatetracyclo[5.4.0.02,5.03,5]undec-8-ene-8-carboxylate (PubChem CID 163433195) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl (1S,2R,6S,7S,11S)-6,11-dihydroxy-2-methyl-10-oxatetracyclo[5.4.0.02,5.03,5]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1S,2R,6S,7S,11S)-6,11-dihydroxy-2-methyl-10-oxatetracyclo[5.4.0.02,5.03,5]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 163433195 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl (1S,2R,6S,7S,11S)-6,11-dihydroxy-2-methyl-10-oxatetracyclo[5.4.0.02,5.03,5]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@H](O)[C@H]2[C@@H]1[C@H](O)C13CC1[C@]23C |
| InChI | InChI=1S/C13H16O5/c1-12-6-3-13(6,12)9(14)7-5(10(15)17-2)4-18-11(16)8(7)12/h4,6-9,11,14,16H,3H2,1-2H3/t6?,7-,8-,9+,11+,12-,13?/m1/s1 |
| InChIKey | ASGMSHFZRYQTAG-ODBXJUATSA-N |
| XLogP | 0.03 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |