About 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide
5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide (PubChem CID 892237) has the molecular formula C16H22BrNO
and a molecular weight of 324.26 g/mol. Its IUPAC name is 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide.
Molecular Properties
| Compound Name | 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide |
| PubChem CID | 892237 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide |
| SMILES | Cc1c(Br)cc(C(=O)NC2CCCCC2)c(C)c1C |
| InChI | InChI=1S/C16H22BrNO/c1-10-11(2)14(9-15(17)12(10)3)16(19)18-13-7-5-4-6-8-13/h9,13H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | DIQAXSYTRUBCEE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide?
The IUPAC name of 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide (CID 892237) is 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide.
What is the SMILES notation for 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide?
The canonical SMILES for 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide is Cc1c(Br)cc(C(=O)NC2CCCCC2)c(C)c1C.
What is the InChIKey of 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide?
The InChIKey is DIQAXSYTRUBCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO/c1-10-11(2)14(9-15(17)12(10)3)16(19)18-13-7-5-4-6-8-13/h9,13H,4-8H2,1-3H3,(H,18,19).
What are the key properties of 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide?
5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide has a molecular weight of 324.26 g/mol, XLogP of 4.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-cyclohexyl-2,3,4-trimethylbenzamide is sourced from PubChem (CID 892237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).