C36H48BN7O7 — CID 89223905
CID 89223905 (PubChem CID 89223905) has the molecular formula C36H48BN7O7 and a molecular weight of 701.63 g/mol.
| Compound Name | CID 89223905 |
|---|---|
| PubChem CID | 89223905 |
| Molecular Formula | C36H48BN7O7 |
| Molecular Weight | 701.63 g/mol |
| Exact Mass | 701.37 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCN(C3CCN(CC(=O)NO)CC3)CC2)cc(C)c1O |
| InChI | InChI=1S/C36H48BN7O7/c1-24-20-25(21-29(37)33(24)46)22-31(34(47)42-18-16-41(17-19-42)27-7-11-40(12-8-27)23-32(45)39-50)51-36(49)43-13-9-28(10-14-43)44-15-6-26-4-2-3-5-30(26)38-35(44)48/h2-5,20-21,27-28,31,46,50H,6-19,22-23H2,1H3,(H,38,48)(H,39,45)/t31-/m1/s1 |
| InChIKey | FGFMLEJKKANLHK-WJOKGBTCSA-N |
| XLogP | 1.21 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|