C34H44BN5O6 — CID 89224022
CID 89224022 (PubChem CID 89224022) has the molecular formula C34H44BN5O6 and a molecular weight of 629.57 g/mol.
| Compound Name | CID 89224022 |
|---|---|
| PubChem CID | 89224022 |
| Molecular Formula | C34H44BN5O6 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.34 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(N3CC[C@@H](O)C3)CC2)cc(C)c1O |
| InChI | InChI=1S/C34H44BN5O6/c1-22-18-23(19-28(35)31(22)42)20-30(32(43)37-12-7-25(8-13-37)39-16-11-27(41)21-39)46-34(45)38-14-9-26(10-15-38)40-17-6-24-4-2-3-5-29(24)36-33(40)44/h2-5,18-19,25-27,30,41-42H,6-17,20-21H2,1H3,(H,36,44)/t27-,30-/m1/s1 |
| InChIKey | BSHKDMYAGLUOKM-POURPWNDSA-N |
| XLogP | 2.15 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|