C33H41BBrN5O7S — CID 89227790
CID 89227790 (PubChem CID 89227790) has the molecular formula C33H41BBrN5O7S and a molecular weight of 742.50 g/mol.
| Compound Name | CID 89227790 |
|---|---|
| PubChem CID | 89227790 |
| Molecular Formula | C33H41BBrN5O7S |
| Molecular Weight | 742.50 g/mol |
| Exact Mass | 741.20 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(N3CCS(=O)(=O)CC3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C33H41BBrN5O7S/c34-26-19-22(20-27(35)30(26)41)21-29(31(42)38-10-6-24(7-11-38)37-15-17-48(45,46)18-16-37)47-33(44)39-12-8-25(9-13-39)40-14-5-23-3-1-2-4-28(23)36-32(40)43/h1-4,19-20,24-25,29,41H,5-18,21H2,(H,36,43)/t29-/m1/s1 |
| InChIKey | WZLWNHDZBLMXTQ-GDLZYMKVSA-N |
| XLogP | 2.27 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|