C36H45BBrN5O7 — CID 89227842
CID 89227842 (PubChem CID 89227842) has the molecular formula C36H45BBrN5O7 and a molecular weight of 750.50 g/mol.
| Compound Name | CID 89227842 |
|---|---|
| PubChem CID | 89227842 |
| Molecular Formula | C36H45BBrN5O7 |
| Molecular Weight | 750.50 g/mol |
| Exact Mass | 749.26 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C3CCN(CC(=O)O)CC3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C36H45BBrN5O7/c37-28-19-23(20-29(38)33(28)46)21-31(34(47)41-14-7-25(8-15-41)24-5-12-40(13-6-24)22-32(44)45)50-36(49)42-16-10-27(11-17-42)43-18-9-26-3-1-2-4-30(26)39-35(43)48/h1-4,19-20,24-25,27,31,46H,5-18,21-22H2,(H,39,48)(H,44,45)/t31-/m1/s1 |
| InChIKey | LSRBTSLLSRSCLH-WJOKGBTCSA-N |
| XLogP | 3.59 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|