C36H43BBrN5O8 — CID 89227793
CID 89227793 (PubChem CID 89227793) has the molecular formula C36H43BBrN5O8 and a molecular weight of 764.48 g/mol.
| Compound Name | CID 89227793 |
|---|---|
| PubChem CID | 89227793 |
| Molecular Formula | C36H43BBrN5O8 |
| Molecular Weight | 764.48 g/mol |
| Exact Mass | 763.24 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C3CCN(C(=O)C(=O)O)CC3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C36H43BBrN5O8/c37-27-19-22(20-28(38)31(27)44)21-30(32(45)40-12-5-23(6-13-40)24-7-14-41(15-8-24)33(46)34(47)48)51-36(50)42-16-10-26(11-17-42)43-18-9-25-3-1-2-4-29(25)39-35(43)49/h1-4,19-20,23-24,26,30,44H,5-18,21H2,(H,39,49)(H,47,48)/t30-/m1/s1 |
| InChIKey | FWDKABTWTRBXDM-SSEXGKCCSA-N |
| XLogP | 3.11 |
| TPSA | 160.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|