C40H51BBrN5O8 — CID 89227812
CID 89227812 (PubChem CID 89227812) has the molecular formula C40H51BBrN5O8 and a molecular weight of 820.59 g/mol.
| Compound Name | CID 89227812 |
|---|---|
| PubChem CID | 89227812 |
| Molecular Formula | C40H51BBrN5O8 |
| Molecular Weight | 820.59 g/mol |
| Exact Mass | 819.30 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C3CCN(C(=O)CCC(=O)OCC)CC3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C40H51BBrN5O8/c1-2-54-36(49)8-7-35(48)44-16-9-27(10-17-44)28-11-18-45(19-12-28)38(51)34(25-26-23-31(41)37(50)32(42)24-26)55-40(53)46-20-14-30(15-21-46)47-22-13-29-5-3-4-6-33(29)43-39(47)52/h3-6,23-24,27-28,30,34,50H,2,7-22,25H2,1H3,(H,43,52)/t34-/m1/s1 |
| InChIKey | TWTIMFMIMXJVNE-UUWRZZSWSA-N |
| XLogP | 4.37 |
| TPSA | 149.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|