C40H52BN5O8 — CID 89223925
CID 89223925 (PubChem CID 89223925) has the molecular formula C40H52BN5O8 and a molecular weight of 741.70 g/mol.
| Compound Name | CID 89223925 |
|---|---|
| PubChem CID | 89223925 |
| Molecular Formula | C40H52BN5O8 |
| Molecular Weight | 741.70 g/mol |
| Exact Mass | 741.39 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(C3CCN(C(=O)CCC(=O)OCC)CC3)CC2)ccc1O |
| InChI | InChI=1S/C40H52BN5O8/c1-2-53-37(49)10-9-36(48)43-18-11-28(12-19-43)29-13-20-44(21-14-29)38(50)35(26-27-7-8-34(47)32(41)25-27)54-40(52)45-22-16-31(17-23-45)46-24-15-30-5-3-4-6-33(30)42-39(46)51/h3-8,25,28-29,31,35,47H,2,9-24,26H2,1H3,(H,42,51)/t35-/m1/s1 |
| InChIKey | HORLROBYJBPYCN-PGUFJCEWSA-N |
| XLogP | 3.61 |
| TPSA | 149.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|