C35H44BN5O7 — CID 89223880
CID 89223880 (PubChem CID 89223880) has the molecular formula C35H44BN5O7 and a molecular weight of 657.58 g/mol.
| Compound Name | CID 89223880 |
|---|---|
| PubChem CID | 89223880 |
| Molecular Formula | C35H44BN5O7 |
| Molecular Weight | 657.58 g/mol |
| Exact Mass | 657.33 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(N3CCC[C@H]3C(=O)OC)CC2)ccc1O |
| InChI | InChI=1S/C35H44BN5O7/c1-47-33(44)29-7-4-15-40(29)25-11-16-38(17-12-25)32(43)31(22-23-8-9-30(42)27(36)21-23)48-35(46)39-18-13-26(14-19-39)41-20-10-24-5-2-3-6-28(24)37-34(41)45/h2-3,5-6,8-9,21,25-26,29,31,42H,4,7,10-20,22H2,1H3,(H,37,45)/t29-,31+/m0/s1 |
| InChIKey | PGXOIEHIDQCXMW-IGYGKHONSA-N |
| XLogP | 2.42 |
| TPSA | 131.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|