C33H44BN7O7S — CID 89227939
CID 89227939 (PubChem CID 89227939) has the molecular formula C33H44BN7O7S and a molecular weight of 693.64 g/mol.
| Compound Name | CID 89227939 |
|---|---|
| PubChem CID | 89227939 |
| Molecular Formula | C33H44BN7O7S |
| Molecular Weight | 693.64 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(N3CCN(S(N)(=O)=O)CC3)CC2)ccc1O |
| InChI | InChI=1S/C33H44BN7O7S/c34-27-21-23(5-6-29(27)42)22-30(31(43)38-12-8-25(9-13-38)37-17-19-40(20-18-37)49(35,46)47)48-33(45)39-14-10-26(11-15-39)41-16-7-24-3-1-2-4-28(24)36-32(41)44/h1-6,21,25-26,30,42H,7-20,22H2,(H,36,44)(H2,35,46,47)/t30-/m1/s1 |
| InChIKey | ZPAWYJXFXLUJID-SSEXGKCCSA-N |
| XLogP | 0.60 |
| TPSA | 169.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.64 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|