C34H43BBrN5O6 — CID 89227949
CID 89227949 (PubChem CID 89227949) has the molecular formula C34H43BBrN5O6 and a molecular weight of 708.46 g/mol.
| Compound Name | CID 89227949 |
|---|---|
| PubChem CID | 89227949 |
| Molecular Formula | C34H43BBrN5O6 |
| Molecular Weight | 708.46 g/mol |
| Exact Mass | 707.25 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C[C@@H](OC(=O)N2CCC(N3CCc4ccccc4NC3=O)CC2)C(=O)N2CCC(N3CCC[C@@H](O)C3)CC2)cc(Br)c1O |
| InChI | InChI=1S/C34H43BBrN5O6/c35-27-18-22(19-28(36)31(27)43)20-30(32(44)38-13-8-24(9-14-38)40-12-3-5-26(42)21-40)47-34(46)39-15-10-25(11-16-39)41-17-7-23-4-1-2-6-29(23)37-33(41)45/h1-2,4,6,18-19,24-26,30,42-43H,3,5,7-17,20-21H2,(H,37,45)/t26-,30-/m1/s1 |
| InChIKey | LETNIEZRPJPDPU-PDDLMNHVSA-N |
| XLogP | 3.00 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|