C19H28N2O3 — CID 89225394
tert-butyl 4-[[4-(1-aminoethenyl)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 89225394) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 4-[[4-(1-aminoethenyl)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(1-aminoethenyl)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89225394 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 4-[[4-(1-aminoethenyl)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | C=C(N)c1ccc(COC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-14(20)16-7-5-15(6-8-16)13-23-17-9-11-21(12-10-17)18(22)24-19(2,3)4/h5-8,17H,1,9-13,20H2,2-4H3 |
| InChIKey | DRDWZLJDMOPIQO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |