About 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene
3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene (PubChem CID 89226706) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene.
Molecular Properties
| Compound Name | 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene |
| PubChem CID | 89226706 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene |
| SMILES | C=C(C)C(SC(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C13H26S/c1-8-11(5)14-12(10(3)4)13(6,7)9-2/h11-12H,3,8-9H2,1-2,4-7H3 |
| InChIKey | AWGJNRUESIEOFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene?
The IUPAC name of 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene (CID 89226706) is 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene.
What is the SMILES notation for 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene?
The canonical SMILES for 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene is C=C(C)C(SC(C)CC)C(C)(C)CC.
What is the InChIKey of 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene?
The InChIKey is AWGJNRUESIEOFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26S/c1-8-11(5)14-12(10(3)4)13(6,7)9-2/h11-12H,3,8-9H2,1-2,4-7H3.
What are the key properties of 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene?
3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene has a molecular weight of 214.42 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-ylsulfanyl-2,4,4-trimethylhex-1-ene is sourced from PubChem (CID 89226706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).