C21H19N3O3 — CID 89227015
4-[1-[3-(4-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-N-prop-2-ynyl-1H-pyrrole-2-carboxamide (PubChem CID 89227015) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-[1-[3-(4-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-N-prop-2-ynyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[1-[3-(4-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-N-prop-2-ynyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 89227015 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4-[1-[3-(4-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]ethenyl]-N-prop-2-ynyl-1H-pyrrole-2-carboxamide |
| SMILES | C#CCNC(=O)c1cc(C(=C)c2c(-c3ccc(OC)cc3)noc2C)c[nH]1 |
| InChI | InChI=1S/C21H19N3O3/c1-5-10-22-21(25)18-11-16(12-23-18)13(2)19-14(3)27-24-20(19)15-6-8-17(26-4)9-7-15/h1,6-9,11-12,23H,2,10H2,3-4H3,(H,22,25) |
| InChIKey | DCOYEWHKEHVKOF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|