C12H20N2O2 — CID 89229025
2-methylbut-3-yn-2-yl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 89229025) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | 2-methylbut-3-yn-2-yl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 89229025 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-methylbut-3-yn-2-yl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C#CC(C)(C)OC(=O)N1C[C@H](C)NC[C@H]1C |
| InChI | InChI=1S/C12H20N2O2/c1-6-12(4,5)16-11(15)14-8-9(2)13-7-10(14)3/h1,9-10,13H,7-8H2,2-5H3/t9-,10+/m0/s1 |
| InChIKey | ZULCBSAMFFCCNU-VHSXEESVSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|