C20H35N6+ — CID 89229330
(Z)-N'-[6-[3-(4-imidazol-1-ylbutyl)imidazol-1-ium-1-yl]hexyl]-N,N'-dimethylethene-1,2-diamine (PubChem CID 89229330) has the molecular formula C20H35N6+ and a molecular weight of 359.54 g/mol. Its IUPAC name is (Z)-N'-[6-[3-(4-imidazol-1-ylbutyl)imidazol-1-ium-1-yl]hexyl]-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N'-[6-[3-(4-imidazol-1-ylbutyl)imidazol-1-ium-1-yl]hexyl]-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 89229330 |
| Molecular Formula | C20H35N6+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | (Z)-N'-[6-[3-(4-imidazol-1-ylbutyl)imidazol-1-ium-1-yl]hexyl]-N,N'-dimethylethene-1,2-diamine |
| SMILES | CN/C=C\N(C)CCCCCC[n+]1ccn(CCCCn2ccnc2)c1 |
| InChI | InChI=1S/C20H35N6/c1-21-9-15-23(2)11-5-3-4-6-13-25-17-18-26(20-25)14-8-7-12-24-16-10-22-19-24/h9-10,15-21H,3-8,11-14H2,1-2H3/q+1/b15-9- |
| InChIKey | AZDZDAJWNOTQED-DHDCSXOGSA-N |
| XLogP | 2.64 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|