C18H32N3O5PS — CID 89231816
4-amino-N-[1-(2-diethoxyphosphorylethyl)piperidin-4-yl]-N-methylbenzenesulfonamide (PubChem CID 89231816) has the molecular formula C18H32N3O5PS and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-amino-N-[1-(2-diethoxyphosphorylethyl)piperidin-4-yl]-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-N-[1-(2-diethoxyphosphorylethyl)piperidin-4-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 89231816 |
| Molecular Formula | C18H32N3O5PS |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-amino-N-[1-(2-diethoxyphosphorylethyl)piperidin-4-yl]-N-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(CCN1CCC(N(C)S(=O)(=O)c2ccc(N)cc2)CC1)OCC |
| InChI | InChI=1S/C18H32N3O5PS/c1-4-25-27(22,26-5-2)15-14-21-12-10-17(11-13-21)20(3)28(23,24)18-8-6-16(19)7-9-18/h6-9,17H,4-5,10-15,19H2,1-3H3 |
| InChIKey | SBJZYTSAQLVOMD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|