C8H11N — CID 89232449
(5Z)-4-methylidenehepta-1,5-dien-3-imine (PubChem CID 89232449) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is (5Z)-4-methylidenehepta-1,5-dien-3-imine.
| Compound Name | (5Z)-4-methylidenehepta-1,5-dien-3-imine |
|---|---|
| PubChem CID | 89232449 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | (5Z)-4-methylidenehepta-1,5-dien-3-imine |
| SMILES | [H]/N=C(\C=C)C(=C)/C=C\C |
| InChI | InChI=1S/C8H11N/c1-4-6-7(3)8(9)5-2/h4-6,9H,2-3H2,1H3/b6-4-,9-8+ |
| InChIKey | LQJZYOURMMVPSZ-LJWGDIBWSA-N |
| XLogP | 2.32 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|