C16H20BrN3OS — CID 89233953
3-(5-bromo-1H-indol-3-yl)-2-imino-N-(5-sulfanylpentyl)propanamide (PubChem CID 89233953) has the molecular formula C16H20BrN3OS and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-2-imino-N-(5-sulfanylpentyl)propanamide.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-2-imino-N-(5-sulfanylpentyl)propanamide |
|---|---|
| PubChem CID | 89233953 |
| Molecular Formula | C16H20BrN3OS |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-2-imino-N-(5-sulfanylpentyl)propanamide |
| SMILES | [H]/N=C(/Cc1c[nH]c2ccc(Br)cc12)C(=O)NCCCCCS |
| InChI | InChI=1S/C16H20BrN3OS/c17-12-4-5-15-13(9-12)11(10-20-15)8-14(18)16(21)19-6-2-1-3-7-22/h4-5,9-10,18,20,22H,1-3,6-8H2,(H,19,21)/b18-14- |
| InChIKey | FHTXANBXONPFIP-JXAWBTAJSA-N |
| XLogP | 3.71 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|