C14H16BrN3O2 — CID 59324195
3-(5-bromo-1H-indol-3-yl)-N-(2-hydroxyethyl)-2-methyliminopropanamide (PubChem CID 59324195) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-N-(2-hydroxyethyl)-2-methyliminopropanamide.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-N-(2-hydroxyethyl)-2-methyliminopropanamide |
|---|---|
| PubChem CID | 59324195 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-N-(2-hydroxyethyl)-2-methyliminopropanamide |
| SMILES | C/N=C(/Cc1c[nH]c2ccc(Br)cc12)C(=O)NCCO |
| InChI | InChI=1S/C14H16BrN3O2/c1-16-13(14(20)17-4-5-19)6-9-8-18-12-3-2-10(15)7-11(9)12/h2-3,7-8,18-19H,4-6H2,1H3,(H,17,20)/b16-13- |
| InChIKey | VQORIIIVGXPWQX-SSZFMOIBSA-N |
| XLogP | 1.65 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|