C20H30BrN3O2Si — CID 59324193
3-(5-bromo-1H-indol-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyliminopropanamide (PubChem CID 59324193) has the molecular formula C20H30BrN3O2Si and a molecular weight of 452.47 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyliminopropanamide.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyliminopropanamide |
|---|---|
| PubChem CID | 59324193 |
| Molecular Formula | C20H30BrN3O2Si |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methyliminopropanamide |
| SMILES | C/N=C(/Cc1c[nH]c2ccc(Br)cc12)C(=O)NCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30BrN3O2Si/c1-20(2,3)27(5,6)26-10-9-23-19(25)18(22-4)11-14-13-24-17-8-7-15(21)12-16(14)17/h7-8,12-13,24H,9-11H2,1-6H3,(H,23,25)/b22-18- |
| InChIKey | BESCNOLPQRVIQI-PYCFMQQDSA-N |
| XLogP | 4.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|