C24H30BrIN6 — CID 89234669
3-bromo-5-[1-[4-(iodomethyl)cyclohexyl]piperidin-3-yl]-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 89234669) has the molecular formula C24H30BrIN6 and a molecular weight of 609.35 g/mol. Its IUPAC name is 3-bromo-5-[1-[4-(iodomethyl)cyclohexyl]piperidin-3-yl]-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-5-[1-[4-(iodomethyl)cyclohexyl]piperidin-3-yl]-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 89234669 |
| Molecular Formula | C24H30BrIN6 |
| Molecular Weight | 609.35 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 3-bromo-5-[1-[4-(iodomethyl)cyclohexyl]piperidin-3-yl]-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Brc1cnn2c(NCc3cccnc3)cc(C3CCCN(C4CCC(CI)CC4)C3)nc12 |
| InChI | InChI=1S/C24H30BrIN6/c25-21-15-29-32-23(28-14-18-3-1-9-27-13-18)11-22(30-24(21)32)19-4-2-10-31(16-19)20-7-5-17(12-26)6-8-20/h1,3,9,11,13,15,17,19-20,28H,2,4-8,10,12,14,16H2 |
| InChIKey | VYPGRVHYQWSCEM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|