2-prop-2-ynylpent-4-yne-1,2-disulfonic acid

C8H10O6S2 — CID 89235333

IUPAC2-prop-2-ynylpent-4-yne-1,2-disulfonic acid
SMILESC#CCC(CC#C)(CS(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C8H10O6S2/c1-3-5-8(6-4-2,16(12,13)14)7-15(9,10)11/h1-2H,5-7H2,(H,9,10,11)(H,12,13,14)
InChIKeyWTNGCCWOZGJVAA-UHFFFAOYSA-N
MW266.30 g/mol
LogP-0.45
Rot. Bonds5

About 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid

2-prop-2-ynylpent-4-yne-1,2-disulfonic acid (PubChem CID 89235333) has the molecular formula C8H10O6S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid.

Molecular Properties

Compound Name2-prop-2-ynylpent-4-yne-1,2-disulfonic acid
PubChem CID89235333
Molecular FormulaC8H10O6S2
Molecular Weight266.30 g/mol
Exact Mass265.99
IUPAC Name2-prop-2-ynylpent-4-yne-1,2-disulfonic acid
SMILESC#CCC(CC#C)(CS(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C8H10O6S2/c1-3-5-8(6-4-2,16(12,13)14)7-15(9,10)11/h1-2H,5-7H2,(H,9,10,11)(H,12,13,14)
InChIKeyWTNGCCWOZGJVAA-UHFFFAOYSA-N
XLogP-0.45
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 5-0.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid?
The IUPAC name of 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid (CID 89235333) is 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid.
What is the SMILES notation for 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid?
The canonical SMILES for 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid is C#CCC(CC#C)(CS(=O)(=O)O)S(=O)(=O)O.
What is the InChIKey of 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid?
The InChIKey is WTNGCCWOZGJVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O6S2/c1-3-5-8(6-4-2,16(12,13)14)7-15(9,10)11/h1-2H,5-7H2,(H,9,10,11)(H,12,13,14).
What are the key properties of 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid?
2-prop-2-ynylpent-4-yne-1,2-disulfonic acid has a molecular weight of 266.30 g/mol, XLogP of -0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynylpent-4-yne-1,2-disulfonic acid is sourced from PubChem (CID 89235333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).