C7H8O6S2 — CID 89235335
hepta-1,6-diyne-4,4-disulfonic acid (PubChem CID 89235335) has the molecular formula C7H8O6S2 and a molecular weight of 252.27 g/mol. Its IUPAC name is hepta-1,6-diyne-4,4-disulfonic acid.
| Compound Name | hepta-1,6-diyne-4,4-disulfonic acid |
|---|---|
| PubChem CID | 89235335 |
| Molecular Formula | C7H8O6S2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | hepta-1,6-diyne-4,4-disulfonic acid |
| SMILES | C#CCC(CC#C)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C7H8O6S2/c1-3-5-7(6-4-2,14(8,9)10)15(11,12)13/h1-2H,5-6H2,(H,8,9,10)(H,11,12,13) |
| InChIKey | NRMPTFVVUAFZPW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|