C23H19F2N3O4S2 — CID 89238238
N-[(3,4-difluorophenyl)methyl]-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide (PubChem CID 89238238) has the molecular formula C23H19F2N3O4S2 and a molecular weight of 503.55 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89238238 |
| Molecular Formula | C23H19F2N3O4S2 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)Nc1cc2c(s1)CN(S(=O)(=O)c1ccc(C(=O)NCc3ccc(F)c(F)c3)cc1)C2 |
| InChI | InChI=1S/C23H19F2N3O4S2/c1-2-21(29)27-22-10-16-12-28(13-20(16)33-22)34(31,32)17-6-4-15(5-7-17)23(30)26-11-14-3-8-18(24)19(25)9-14/h2-10H,1,11-13H2,(H,26,30)(H,27,29) |
| InChIKey | AAEHNWFYTWIAHG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|