C14H16BrN3O — CID 892389
4-bromo-N-(3,4-dimethylphenyl)-1-ethylpyrazole-5-carboxamide (PubChem CID 892389) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 4-bromo-N-(3,4-dimethylphenyl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-(3,4-dimethylphenyl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 892389 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 4-bromo-N-(3,4-dimethylphenyl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(Br)c1C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H16BrN3O/c1-4-18-13(12(15)8-16-18)14(19)17-11-6-5-9(2)10(3)7-11/h5-8H,4H2,1-3H3,(H,17,19) |
| InChIKey | GYUVVLFDXOVSJM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |