C18H16BrN3OS — CID 4518276
4-bromo-1-ethyl-N-(2-phenylsulfanylphenyl)pyrazole-5-carboxamide (PubChem CID 4518276) has the molecular formula C18H16BrN3OS and a molecular weight of 402.32 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(2-phenylsulfanylphenyl)pyrazole-5-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(2-phenylsulfanylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4518276 |
| Molecular Formula | C18H16BrN3OS |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 4-bromo-1-ethyl-N-(2-phenylsulfanylphenyl)pyrazole-5-carboxamide |
| SMILES | CCn1ncc(Br)c1C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C18H16BrN3OS/c1-2-22-17(14(19)12-20-22)18(23)21-15-10-6-7-11-16(15)24-13-8-4-3-5-9-13/h3-12H,2H2,1H3,(H,21,23) |
| InChIKey | HOIWKIGQBDNZPC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |