C15H18N4OS — CID 65357588
4-amino-1-ethyl-N-(2-prop-2-enylsulfanylphenyl)pyrazole-5-carboxamide (PubChem CID 65357588) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(2-prop-2-enylsulfanylphenyl)pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(2-prop-2-enylsulfanylphenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65357588 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-amino-1-ethyl-N-(2-prop-2-enylsulfanylphenyl)pyrazole-5-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1c(N)cnn1CC |
| InChI | InChI=1S/C15H18N4OS/c1-3-9-21-13-8-6-5-7-12(13)18-15(20)14-11(16)10-17-19(14)4-2/h3,5-8,10H,1,4,9,16H2,2H3,(H,18,20) |
| InChIKey | AEMYGGPEYNVUGK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|