C13H14N4OS — CID 63103213
4-amino-N-(2-prop-2-enylsulfanylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 63103213) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-amino-N-(2-prop-2-enylsulfanylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2-prop-2-enylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63103213 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-amino-N-(2-prop-2-enylsulfanylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1[nH]ncc1N |
| InChI | InChI=1S/C13H14N4OS/c1-2-7-19-11-6-4-3-5-10(11)16-13(18)12-9(14)8-15-17-12/h2-6,8H,1,7,14H2,(H,15,17)(H,16,18) |
| InChIKey | RTWSHFJZYAHCEO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|