C18H15N3O2S — CID 17414247
4-oxo-N-(2-prop-2-enylsulfanylphenyl)-3H-phthalazine-1-carboxamide (PubChem CID 17414247) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is 4-oxo-N-(2-prop-2-enylsulfanylphenyl)-3H-phthalazine-1-carboxamide.
| Compound Name | 4-oxo-N-(2-prop-2-enylsulfanylphenyl)-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 17414247 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-oxo-N-(2-prop-2-enylsulfanylphenyl)-3H-phthalazine-1-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H15N3O2S/c1-2-11-24-15-10-6-5-9-14(15)19-18(23)16-12-7-3-4-8-13(12)17(22)21-20-16/h2-10H,1,11H2,(H,19,23)(H,21,22) |
| InChIKey | VBOULMZNOXUJTR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|