About tris(2-methylhexyl) borate
tris(2-methylhexyl) borate (PubChem CID 89239573) has the molecular formula C21H45BO3
and a molecular weight of 356.40 g/mol. Its IUPAC name is tris(2-methylhexyl) borate.
Molecular Properties
| Compound Name | tris(2-methylhexyl) borate |
| PubChem CID | 89239573 |
| Molecular Formula | C21H45BO3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.35 |
| IUPAC Name | tris(2-methylhexyl) borate |
| SMILES | CCCCC(C)COB(OCC(C)CCCC)OCC(C)CCCC |
| InChI | InChI=1S/C21H45BO3/c1-7-10-13-19(4)16-23-22(24-17-20(5)14-11-8-2)25-18-21(6)15-12-9-3/h19-21H,7-18H2,1-6H3 |
| InChIKey | TUXHRHRKPMYPCM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(2-methylhexyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-methylhexyl) borate?
The IUPAC name of tris(2-methylhexyl) borate (CID 89239573) is tris(2-methylhexyl) borate.
What is the SMILES notation for tris(2-methylhexyl) borate?
The canonical SMILES for tris(2-methylhexyl) borate is CCCCC(C)COB(OCC(C)CCCC)OCC(C)CCCC.
What is the InChIKey of tris(2-methylhexyl) borate?
The InChIKey is TUXHRHRKPMYPCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45BO3/c1-7-10-13-19(4)16-23-22(24-17-20(5)14-11-8-2)25-18-21(6)15-12-9-3/h19-21H,7-18H2,1-6H3.
What are the key properties of tris(2-methylhexyl) borate?
tris(2-methylhexyl) borate has a molecular weight of 356.40 g/mol, XLogP of 6.50, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-methylhexyl) borate is sourced from PubChem (CID 89239573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).